About 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride
2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride (PubChem CID 22355469) has the molecular formula C19H21ClN2O2
and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride |
| PubChem CID | 22355469 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride |
| SMILES | Cc1cc2c(c3c1N(Cc1ccccc1)C(=O)C3)OC(CN)C2.Cl |
| InChI | InChI=1S/C19H20N2O2.ClH/c1-12-7-14-8-15(10-20)23-19(14)16-9-17(22)21(18(12)16)11-13-5-3-2-4-6-13;/h2-7,15H,8-11,20H2,1H3;1H |
| InChIKey | RPDVWYFSMJXABK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride?
The IUPAC name of 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride (CID 22355469) is 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride.
What is the SMILES notation for 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride?
The canonical SMILES for 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride is Cc1cc2c(c3c1N(Cc1ccccc1)C(=O)C3)OC(CN)C2.Cl.
What is the InChIKey of 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride?
The InChIKey is RPDVWYFSMJXABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2.ClH/c1-12-7-14-8-15(10-20)23-19(14)16-9-17(22)21(18(12)16)11-13-5-3-2-4-6-13;/h2-7,15H,8-11,20H2,1H3;1H.
What are the key properties of 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride?
2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride has a molecular weight of 344.84 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6-benzyl-5-methyl-3,8-dihydro-2H-furo[2,3-e]indol-7-one;hydrochloride is sourced from PubChem (CID 22355469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).