About N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide (PubChem CID 22355526) has the molecular formula C10H19NO6
and a molecular weight of 249.26 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide |
| PubChem CID | 22355526 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide |
| SMILES | COC1OC(CO)C(O)C(O)C1N(C)C(C)=O |
| InChI | InChI=1S/C10H19NO6/c1-5(13)11(2)7-9(15)8(14)6(4-12)17-10(7)16-3/h6-10,12,14-15H,4H2,1-3H3 |
| InChIKey | YSEZPAADHSAMBE-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide?
The IUPAC name of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide (CID 22355526) is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide.
What is the SMILES notation for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide?
The canonical SMILES for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide is COC1OC(CO)C(O)C(O)C1N(C)C(C)=O.
What is the InChIKey of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide?
The InChIKey is YSEZPAADHSAMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO6/c1-5(13)11(2)7-9(15)8(14)6(4-12)17-10(7)16-3/h6-10,12,14-15H,4H2,1-3H3.
What are the key properties of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide?
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide has a molecular weight of 249.26 g/mol, XLogP of -2.08, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]-N-methylacetamide is sourced from PubChem (CID 22355526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).