About 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 2235553) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide |
| PubChem CID | 2235553 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc(C(C)C)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O3/c1-10(2)13-5-7-14(8-6-13)17-15(21)9-19-12(4)16(20(22)23)11(3)18-19/h5-8,10H,9H2,1-4H3,(H,17,21) |
| InChIKey | SLQJJTHJRGGFCR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide?
The IUPAC name of 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide (CID 2235553) is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide.
What is the SMILES notation for 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide?
The canonical SMILES for 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide is Cc1nn(CC(=O)Nc2ccc(C(C)C)cc2)c(C)c1[N+](=O)[O-].
What is the InChIKey of 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide?
The InChIKey is SLQJJTHJRGGFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O3/c1-10(2)13-5-7-14(8-6-13)17-15(21)9-19-12(4)16(20(22)23)11(3)18-19/h5-8,10H,9H2,1-4H3,(H,17,21).
What are the key properties of 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide?
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide has a molecular weight of 316.36 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide is sourced from PubChem (CID 2235553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).