About 1-benzazepin-7-one;hydrochloride
1-benzazepin-7-one;hydrochloride (PubChem CID 22356005) has the molecular formula C10H8ClNO
and a molecular weight of 193.63 g/mol. Its IUPAC name is 1-benzazepin-7-one;hydrochloride.
Molecular Properties
| Compound Name | 1-benzazepin-7-one;hydrochloride |
| PubChem CID | 22356005 |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 1-benzazepin-7-one;hydrochloride |
| SMILES | Cl.O=c1ccc2nccccc-2c1 |
| InChI | InChI=1S/C10H7NO.ClH/c12-9-4-5-10-8(7-9)3-1-2-6-11-10;/h1-7H;1H |
| InChIKey | CXZJFBQKVXAFTA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzazepin-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzazepin-7-one;hydrochloride?
The IUPAC name of 1-benzazepin-7-one;hydrochloride (CID 22356005) is 1-benzazepin-7-one;hydrochloride.
What is the SMILES notation for 1-benzazepin-7-one;hydrochloride?
The canonical SMILES for 1-benzazepin-7-one;hydrochloride is Cl.O=c1ccc2nccccc-2c1.
What is the InChIKey of 1-benzazepin-7-one;hydrochloride?
The InChIKey is CXZJFBQKVXAFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.ClH/c12-9-4-5-10-8(7-9)3-1-2-6-11-10;/h1-7H;1H.
What are the key properties of 1-benzazepin-7-one;hydrochloride?
1-benzazepin-7-one;hydrochloride has a molecular weight of 193.63 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzazepin-7-one;hydrochloride is sourced from PubChem (CID 22356005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).