About 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol
1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol (PubChem CID 22356038) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol.
Molecular Properties
| Compound Name | 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol |
| PubChem CID | 22356038 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol |
| SMILES | CCN1CCC(O)C1.OCCN1CCCC1 |
| InChI | InChI=1S/2C6H13NO/c1-2-7-4-3-6(8)5-7;8-6-5-7-3-1-2-4-7/h6,8H,2-5H2,1H3;8H,1-6H2 |
| InChIKey | HODUYSOLFSPMRF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol?
The IUPAC name of 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol (CID 22356038) is 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol.
What is the SMILES notation for 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol?
The canonical SMILES for 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol is CCN1CCC(O)C1.OCCN1CCCC1.
What is the InChIKey of 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol?
The InChIKey is HODUYSOLFSPMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13NO/c1-2-7-4-3-6(8)5-7;8-6-5-7-3-1-2-4-7/h6,8H,2-5H2,1H3;8H,1-6H2.
What are the key properties of 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol?
1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol has a molecular weight of 230.35 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-3-ol;2-pyrrolidin-1-ylethanol is sourced from PubChem (CID 22356038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).