About 2,5-dioxohexane-1,6-disulfonyl chloride
2,5-dioxohexane-1,6-disulfonyl chloride (PubChem CID 22357099) has the molecular formula C6H8Cl2O6S2
and a molecular weight of 311.16 g/mol. Its IUPAC name is 2,5-dioxohexane-1,6-disulfonyl chloride.
Molecular Properties
| Compound Name | 2,5-dioxohexane-1,6-disulfonyl chloride |
| PubChem CID | 22357099 |
| Molecular Formula | C6H8Cl2O6S2 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.91 |
| IUPAC Name | 2,5-dioxohexane-1,6-disulfonyl chloride |
| SMILES | O=C(CCC(=O)CS(=O)(=O)Cl)CS(=O)(=O)Cl |
| InChI | InChI=1S/C6H8Cl2O6S2/c7-15(11,12)3-5(9)1-2-6(10)4-16(8,13)14/h1-4H2 |
| InChIKey | XGBHHSCPYZMWRL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-dioxohexane-1,6-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxohexane-1,6-disulfonyl chloride?
The IUPAC name of 2,5-dioxohexane-1,6-disulfonyl chloride (CID 22357099) is 2,5-dioxohexane-1,6-disulfonyl chloride.
What is the SMILES notation for 2,5-dioxohexane-1,6-disulfonyl chloride?
The canonical SMILES for 2,5-dioxohexane-1,6-disulfonyl chloride is O=C(CCC(=O)CS(=O)(=O)Cl)CS(=O)(=O)Cl.
What is the InChIKey of 2,5-dioxohexane-1,6-disulfonyl chloride?
The InChIKey is XGBHHSCPYZMWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O6S2/c7-15(11,12)3-5(9)1-2-6(10)4-16(8,13)14/h1-4H2.
What are the key properties of 2,5-dioxohexane-1,6-disulfonyl chloride?
2,5-dioxohexane-1,6-disulfonyl chloride has a molecular weight of 311.16 g/mol, XLogP of 0.04, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxohexane-1,6-disulfonyl chloride is sourced from PubChem (CID 22357099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).