About 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one
4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one (PubChem CID 22357110) has the molecular formula C13H11N3O3
and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one |
| PubChem CID | 22357110 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one |
| SMILES | O=c1cc(O)nc[nH]1.O=c1cc2ccccc2c[nH]1 |
| InChI | InChI=1S/C9H7NO.C4H4N2O2/c11-9-5-7-3-1-2-4-8(7)6-10-9;7-3-1-4(8)6-2-5-3/h1-6H,(H,10,11);1-2H,(H2,5,6,7,8) |
| InChIKey | YMLUWASURHTLBT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one?
The IUPAC name of 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one (CID 22357110) is 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one.
What is the SMILES notation for 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one?
The canonical SMILES for 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one is O=c1cc(O)nc[nH]1.O=c1cc2ccccc2c[nH]1.
What is the InChIKey of 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one?
The InChIKey is YMLUWASURHTLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C4H4N2O2/c11-9-5-7-3-1-2-4-8(7)6-10-9;7-3-1-4(8)6-2-5-3/h1-6H,(H,10,11);1-2H,(H2,5,6,7,8).
What are the key properties of 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one?
4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one has a molecular weight of 257.25 g/mol, XLogP of 1.00, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1H-pyrimidin-6-one;2H-isoquinolin-3-one is sourced from PubChem (CID 22357110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).