C13H19N — CID 22357494
spiro[1,2,6,7-tetrahydroindene-3,4'-piperidine] (PubChem CID 22357494) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is spiro[1,2,6,7-tetrahydroindene-3,4'-piperidine].
| Compound Name | spiro[1,2,6,7-tetrahydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 22357494 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | spiro[1,2,6,7-tetrahydroindene-3,4'-piperidine] |
| SMILES | C1=CC2=C(CC1)CCC21CCNCC1 |
| InChI | InChI=1S/C13H19N/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13/h2,4,14H,1,3,5-10H2 |
| InChIKey | KLKAHCJKMNLKGK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |