C20H16O4 — CID 2235896
(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) benzoate (PubChem CID 2235896) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) benzoate.
| Compound Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) benzoate |
|---|---|
| PubChem CID | 2235896 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) benzoate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCCC3)c1ccccc1 |
| InChI | InChI=1S/C20H16O4/c21-19(13-6-2-1-3-7-13)23-14-10-11-16-15-8-4-5-9-17(15)20(22)24-18(16)12-14/h1-3,6-7,10-12H,4-5,8-9H2 |
| InChIKey | HDBDDEFTKCWERY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|