About 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile
2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile (PubChem CID 22359101) has the molecular formula C26H18N4
and a molecular weight of 386.46 g/mol. Its IUPAC name is 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile.
Molecular Properties
| Compound Name | 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile |
| PubChem CID | 22359101 |
| Molecular Formula | C26H18N4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile |
| SMILES | N#CC(c1ccccc1)(c1ccncc1)C(C#N)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C26H18N4/c27-19-25(21-7-3-1-4-8-21,23-11-15-29-16-12-23)26(20-28,22-9-5-2-6-10-22)24-13-17-30-18-14-24/h1-18H |
| InChIKey | KNRXNSKOPUIHIK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile?
The IUPAC name of 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile (CID 22359101) is 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile.
What is the SMILES notation for 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile?
The canonical SMILES for 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile is N#CC(c1ccccc1)(c1ccncc1)C(C#N)(c1ccccc1)c1ccncc1.
What is the InChIKey of 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile?
The InChIKey is KNRXNSKOPUIHIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N4/c27-19-25(21-7-3-1-4-8-21,23-11-15-29-16-12-23)26(20-28,22-9-5-2-6-10-22)24-13-17-30-18-14-24/h1-18H.
What are the key properties of 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile?
2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile has a molecular weight of 386.46 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyl-2,3-dipyridin-4-ylbutanedinitrile is sourced from PubChem (CID 22359101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).