C3H7N3S — CID 22359599
2-methyl-1,3-dihydro-1,2,4-triazole-3-thiol (PubChem CID 22359599) has the molecular formula C3H7N3S and a molecular weight of 117.18 g/mol. Its IUPAC name is 2-methyl-1,3-dihydro-1,2,4-triazole-3-thiol.
| Compound Name | 2-methyl-1,3-dihydro-1,2,4-triazole-3-thiol |
|---|---|
| PubChem CID | 22359599 |
| Molecular Formula | C3H7N3S |
| Molecular Weight | 117.18 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 2-methyl-1,3-dihydro-1,2,4-triazole-3-thiol |
| SMILES | CN1NC=NC1S |
| InChI | InChI=1S/C3H7N3S/c1-6-3(7)4-2-5-6/h2-3,7H,1H3,(H,4,5) |
| InChIKey | DQSPQIPLFYIAFQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|