C25H42N2O4 — CID 22359737
1,1-dicyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine (PubChem CID 22359737) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is 1,1-dicyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine.
| Compound Name | 1,1-dicyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine |
|---|---|
| PubChem CID | 22359737 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 1,1-dicyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine |
| SMILES | C1CCC(C(C2CCCCC2)(N(CC2CO2)CC2CO2)N(CC2CO2)CC2CO2)CC1 |
| InChI | InChI=1S/C25H42N2O4/c1-3-7-19(8-4-1)25(20-9-5-2-6-10-20,26(11-21-15-28-21)12-22-16-29-22)27(13-23-17-30-23)14-24-18-31-24/h19-24H,1-18H2 |
| InChIKey | ZGKCZFYOKMXNFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|