About 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine
4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 22359756) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 22359756 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | Cc1cccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C22H17N3/c1-16-7-6-8-17(13-16)18-14-21(19-9-2-4-11-23-19)25-22(15-18)20-10-3-5-12-24-20/h2-15H,1H3 |
| InChIKey | AVJJOABAVQVERO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine (CID 22359756) is 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine is Cc1cccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c1.
What is the InChIKey of 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine?
The InChIKey is AVJJOABAVQVERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3/c1-16-7-6-8-17(13-16)18-14-21(19-9-2-4-11-23-19)25-22(15-18)20-10-3-5-12-24-20/h2-15H,1H3.
What are the key properties of 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine?
4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine has a molecular weight of 323.40 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylphenyl)-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 22359756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).