About (4-phenylphenyl) piperidine-1-carboxylate
(4-phenylphenyl) piperidine-1-carboxylate (PubChem CID 2236013) has the molecular formula C18H19NO2
and a molecular weight of 281.36 g/mol. Its IUPAC name is (4-phenylphenyl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-phenylphenyl) piperidine-1-carboxylate |
| PubChem CID | 2236013 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (4-phenylphenyl) piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H19NO2/c20-18(19-13-5-2-6-14-19)21-17-11-9-16(10-12-17)15-7-3-1-4-8-15/h1,3-4,7-12H,2,5-6,13-14H2 |
| InChIKey | WSDRGWSHRBCGBE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-phenylphenyl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl) piperidine-1-carboxylate?
The IUPAC name of (4-phenylphenyl) piperidine-1-carboxylate (CID 2236013) is (4-phenylphenyl) piperidine-1-carboxylate.
What is the SMILES notation for (4-phenylphenyl) piperidine-1-carboxylate?
The canonical SMILES for (4-phenylphenyl) piperidine-1-carboxylate is O=C(Oc1ccc(-c2ccccc2)cc1)N1CCCCC1.
What is the InChIKey of (4-phenylphenyl) piperidine-1-carboxylate?
The InChIKey is WSDRGWSHRBCGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c20-18(19-13-5-2-6-14-19)21-17-11-9-16(10-12-17)15-7-3-1-4-8-15/h1,3-4,7-12H,2,5-6,13-14H2.
What are the key properties of (4-phenylphenyl) piperidine-1-carboxylate?
(4-phenylphenyl) piperidine-1-carboxylate has a molecular weight of 281.36 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl) piperidine-1-carboxylate is sourced from PubChem (CID 2236013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).