About 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine (PubChem CID 22360926) has the molecular formula C21H21F6NO
and a molecular weight of 417.39 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine |
| PubChem CID | 22360926 |
| Molecular Formula | C21H21F6NO |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine |
| SMILES | NC1(c2ccccc2)CCCCC1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F6NO/c22-20(23,24)16-10-14(11-17(12-16)21(25,26)27)13-29-18-8-4-5-9-19(18,28)15-6-2-1-3-7-15/h1-3,6-7,10-12,18H,4-5,8-9,13,28H2 |
| InChIKey | TWCMNGWGSFJDHQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine?
The IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine (CID 22360926) is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine.
What is the SMILES notation for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine?
The canonical SMILES for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine is NC1(c2ccccc2)CCCCC1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine?
The InChIKey is TWCMNGWGSFJDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F6NO/c22-20(23,24)16-10-14(11-17(12-16)21(25,26)27)13-29-18-8-4-5-9-19(18,28)15-6-2-1-3-7-15/h1-3,6-7,10-12,18H,4-5,8-9,13,28H2.
What are the key properties of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine?
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine has a molecular weight of 417.39 g/mol, XLogP of 6.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylcyclohexan-1-amine is sourced from PubChem (CID 22360926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).