About N-phenyloxan-4-amine
N-phenyloxan-4-amine (PubChem CID 22361236) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-phenyloxan-4-amine.
Molecular Properties
| Compound Name | N-phenyloxan-4-amine |
| PubChem CID | 22361236 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-phenyloxan-4-amine |
| SMILES | c1ccc(NC2CCOCC2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-10(5-3-1)12-11-6-8-13-9-7-11/h1-5,11-12H,6-9H2 |
| InChIKey | CLJVGDCRSDRHTR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyloxan-4-amine?
The IUPAC name of N-phenyloxan-4-amine (CID 22361236) is N-phenyloxan-4-amine.
What is the SMILES notation for N-phenyloxan-4-amine?
The canonical SMILES for N-phenyloxan-4-amine is c1ccc(NC2CCOCC2)cc1.
What is the InChIKey of N-phenyloxan-4-amine?
The InChIKey is CLJVGDCRSDRHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-4-10(5-3-1)12-11-6-8-13-9-7-11/h1-5,11-12H,6-9H2.
What are the key properties of N-phenyloxan-4-amine?
N-phenyloxan-4-amine has a molecular weight of 177.25 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyloxan-4-amine is sourced from PubChem (CID 22361236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).