About 5-fluoro-2,2-dihydroxyindene-1,3-dione
5-fluoro-2,2-dihydroxyindene-1,3-dione (PubChem CID 22361311) has the molecular formula C9H5FO4
and a molecular weight of 196.13 g/mol. Its IUPAC name is 5-fluoro-2,2-dihydroxyindene-1,3-dione.
Molecular Properties
| Compound Name | 5-fluoro-2,2-dihydroxyindene-1,3-dione |
| PubChem CID | 22361311 |
| Molecular Formula | C9H5FO4 |
| Molecular Weight | 196.13 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 5-fluoro-2,2-dihydroxyindene-1,3-dione |
| SMILES | O=C1c2ccc(F)cc2C(=O)C1(O)O |
| InChI | InChI=1S/C9H5FO4/c10-4-1-2-5-6(3-4)8(12)9(13,14)7(5)11/h1-3,13-14H |
| InChIKey | FGEXOKDSGCWVPT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,2-dihydroxyindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,2-dihydroxyindene-1,3-dione?
The IUPAC name of 5-fluoro-2,2-dihydroxyindene-1,3-dione (CID 22361311) is 5-fluoro-2,2-dihydroxyindene-1,3-dione.
What is the SMILES notation for 5-fluoro-2,2-dihydroxyindene-1,3-dione?
The canonical SMILES for 5-fluoro-2,2-dihydroxyindene-1,3-dione is O=C1c2ccc(F)cc2C(=O)C1(O)O.
What is the InChIKey of 5-fluoro-2,2-dihydroxyindene-1,3-dione?
The InChIKey is FGEXOKDSGCWVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FO4/c10-4-1-2-5-6(3-4)8(12)9(13,14)7(5)11/h1-3,13-14H.
What are the key properties of 5-fluoro-2,2-dihydroxyindene-1,3-dione?
5-fluoro-2,2-dihydroxyindene-1,3-dione has a molecular weight of 196.13 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,2-dihydroxyindene-1,3-dione is sourced from PubChem (CID 22361311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).