C8H15N3 — CID 22361674
9-methyl-1,2,6,7,8,9a-hexahydropyrimido[1,2-a]pyrimidine (PubChem CID 22361674) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 9-methyl-1,2,6,7,8,9a-hexahydropyrimido[1,2-a]pyrimidine.
| Compound Name | 9-methyl-1,2,6,7,8,9a-hexahydropyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 22361674 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 9-methyl-1,2,6,7,8,9a-hexahydropyrimido[1,2-a]pyrimidine |
| SMILES | CN1CCCN2C=CCNC12 |
| InChI | InChI=1S/C8H15N3/c1-10-5-3-7-11-6-2-4-9-8(10)11/h2,6,8-9H,3-5,7H2,1H3 |
| InChIKey | PZAUZOXWTHJXKO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |