C8H14N4O — CID 22361901
5-(4-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 22361901) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-(4-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(4-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 22361901 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-(4-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CC1CCNC(c2nc(N)no2)C1 |
| InChI | InChI=1S/C8H14N4O/c1-5-2-3-10-6(4-5)7-11-8(9)12-13-7/h5-6,10H,2-4H2,1H3,(H2,9,12) |
| InChIKey | NWRZYPJRDKHTDS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |