About 1,3-dioxol-4-ylboronic acid
1,3-dioxol-4-ylboronic acid (PubChem CID 22362287) has the molecular formula C3H5BO4
and a molecular weight of 115.88 g/mol. Its IUPAC name is 1,3-dioxol-4-ylboronic acid.
Molecular Properties
| Compound Name | 1,3-dioxol-4-ylboronic acid |
| PubChem CID | 22362287 |
| Molecular Formula | C3H5BO4 |
| Molecular Weight | 115.88 g/mol |
| Exact Mass | 116.03 |
| IUPAC Name | 1,3-dioxol-4-ylboronic acid |
| SMILES | OB(O)C1=COCO1 |
| InChI | InChI=1S/C3H5BO4/c5-4(6)3-1-7-2-8-3/h1,5-6H,2H2 |
| InChIKey | CKIDZFDJJHOQAL-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.88 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxol-4-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxol-4-ylboronic acid?
The IUPAC name of 1,3-dioxol-4-ylboronic acid (CID 22362287) is 1,3-dioxol-4-ylboronic acid.
What is the SMILES notation for 1,3-dioxol-4-ylboronic acid?
The canonical SMILES for 1,3-dioxol-4-ylboronic acid is OB(O)C1=COCO1.
What is the InChIKey of 1,3-dioxol-4-ylboronic acid?
The InChIKey is CKIDZFDJJHOQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BO4/c5-4(6)3-1-7-2-8-3/h1,5-6H,2H2.
What are the key properties of 1,3-dioxol-4-ylboronic acid?
1,3-dioxol-4-ylboronic acid has a molecular weight of 115.88 g/mol, XLogP of -1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxol-4-ylboronic acid is sourced from PubChem (CID 22362287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).