About tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid
tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid (PubChem CID 22362441) has the molecular formula C18H32N2O6
and a molecular weight of 372.46 g/mol. Its IUPAC name is tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid.
Molecular Properties
| Compound Name | tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid |
| PubChem CID | 22362441 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NC2CCCCC2)CC1.O=C(O)O |
| InChI | InChI=1S/C17H30N2O3.CH2O3/c1-17(2,3)22-16(21)19-11-9-13(10-12-19)15(20)18-14-7-5-4-6-8-14;2-1(3)4/h13-14H,4-12H2,1-3H3,(H,18,20);(H2,2,3,4) |
| InChIKey | ZBERFYUOBJDJQZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid?
The IUPAC name of tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid (CID 22362441) is tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid.
What is the SMILES notation for tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid?
The canonical SMILES for tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid is CC(C)(C)OC(=O)N1CCC(C(=O)NC2CCCCC2)CC1.O=C(O)O.
What is the InChIKey of tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid?
The InChIKey is ZBERFYUOBJDJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3.CH2O3/c1-17(2,3)22-16(21)19-11-9-13(10-12-19)15(20)18-14-7-5-4-6-8-14;2-1(3)4/h13-14H,4-12H2,1-3H3,(H,18,20);(H2,2,3,4).
What are the key properties of tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid?
tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid has a molecular weight of 372.46 g/mol, XLogP of 3.30, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(cyclohexylcarbamoyl)piperidine-1-carboxylate;carbonic acid is sourced from PubChem (CID 22362441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).