C20H23N3O5 — CID 22363124
1-ethyl-3-(4-nitrophenoxy)azepane;2-nitrobicyclo[2.2.0]hexa-1(4),2,5-triene (PubChem CID 22363124) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-ethyl-3-(4-nitrophenoxy)azepane;2-nitrobicyclo[2.2.0]hexa-1(4),2,5-triene.
| Compound Name | 1-ethyl-3-(4-nitrophenoxy)azepane;2-nitrobicyclo[2.2.0]hexa-1(4),2,5-triene |
|---|---|
| PubChem CID | 22363124 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-ethyl-3-(4-nitrophenoxy)azepane;2-nitrobicyclo[2.2.0]hexa-1(4),2,5-triene |
| SMILES | CCN1CCCCC(Oc2ccc([N+](=O)[O-])cc2)C1.O=[N+]([O-])c1cc2ccc1=2 |
| InChI | InChI=1S/C14H20N2O3.C6H3NO2/c1-2-15-10-4-3-5-14(11-15)19-13-8-6-12(7-9-13)16(17)18;8-7(9)6-3-4-1-2-5(4)6/h6-9,14H,2-5,10-11H2,1H3;1-3H |
| InChIKey | BSRDVPWNAWMRIW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|