About 3-phenyl-3,4-dihydropyrazol-5-one
3-phenyl-3,4-dihydropyrazol-5-one (PubChem CID 22363954) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 3-phenyl-3,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-phenyl-3,4-dihydropyrazol-5-one |
| PubChem CID | 22363954 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 3-phenyl-3,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(c2ccccc2)N=N1 |
| InChI | InChI=1S/C9H8N2O/c12-9-6-8(10-11-9)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | XHSOSAFWCVEPDK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-3,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-3,4-dihydropyrazol-5-one?
The IUPAC name of 3-phenyl-3,4-dihydropyrazol-5-one (CID 22363954) is 3-phenyl-3,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-phenyl-3,4-dihydropyrazol-5-one?
The canonical SMILES for 3-phenyl-3,4-dihydropyrazol-5-one is O=C1CC(c2ccccc2)N=N1.
What is the InChIKey of 3-phenyl-3,4-dihydropyrazol-5-one?
The InChIKey is XHSOSAFWCVEPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9-6-8(10-11-9)7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 3-phenyl-3,4-dihydropyrazol-5-one?
3-phenyl-3,4-dihydropyrazol-5-one has a molecular weight of 160.18 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-3,4-dihydropyrazol-5-one is sourced from PubChem (CID 22363954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).