diethyl 2,2-bis(3-aminopropyl)propanedioate

C13H26N2O4 — CID 22364634

IUPACdiethyl 2,2-bis(3-aminopropyl)propanedioate
SMILESCCOC(=O)C(CCCN)(CCCN)C(=O)OCC
InChIInChI=1S/C13H26N2O4/c1-3-18-11(16)13(7-5-9-14,8-6-10-15)12(17)19-4-2/h3-10,14-15H2,1-2H3
InChIKeyHVUBGLNHJACNJB-UHFFFAOYSA-N
MW274.36 g/mol
LogP0.58
Rot. Bonds10

About diethyl 2,2-bis(3-aminopropyl)propanedioate

diethyl 2,2-bis(3-aminopropyl)propanedioate (PubChem CID 22364634) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is diethyl 2,2-bis(3-aminopropyl)propanedioate.

Molecular Properties

Compound Namediethyl 2,2-bis(3-aminopropyl)propanedioate
PubChem CID22364634
Molecular FormulaC13H26N2O4
Molecular Weight274.36 g/mol
Exact Mass274.19
IUPAC Namediethyl 2,2-bis(3-aminopropyl)propanedioate
SMILESCCOC(=O)C(CCCN)(CCCN)C(=O)OCC
InChIInChI=1S/C13H26N2O4/c1-3-18-11(16)13(7-5-9-14,8-6-10-15)12(17)19-4-2/h3-10,14-15H2,1-2H3
InChIKeyHVUBGLNHJACNJB-UHFFFAOYSA-N
XLogP0.58
TPSA104.64 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze diethyl 2,2-bis(3-aminopropyl)propanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,2-bis(3-aminopropyl)propanedioate?
The IUPAC name of diethyl 2,2-bis(3-aminopropyl)propanedioate (CID 22364634) is diethyl 2,2-bis(3-aminopropyl)propanedioate.
What is the SMILES notation for diethyl 2,2-bis(3-aminopropyl)propanedioate?
The canonical SMILES for diethyl 2,2-bis(3-aminopropyl)propanedioate is CCOC(=O)C(CCCN)(CCCN)C(=O)OCC.
What is the InChIKey of diethyl 2,2-bis(3-aminopropyl)propanedioate?
The InChIKey is HVUBGLNHJACNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4/c1-3-18-11(16)13(7-5-9-14,8-6-10-15)12(17)19-4-2/h3-10,14-15H2,1-2H3.
What are the key properties of diethyl 2,2-bis(3-aminopropyl)propanedioate?
diethyl 2,2-bis(3-aminopropyl)propanedioate has a molecular weight of 274.36 g/mol, XLogP of 0.58, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,2-bis(3-aminopropyl)propanedioate is sourced from PubChem (CID 22364634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).