C19H15F4N3O3S — CID 2236478
N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 2236478) has the molecular formula C19H15F4N3O3S and a molecular weight of 441.41 g/mol. Its IUPAC name is N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 2236478 |
| Molecular Formula | C19H15F4N3O3S |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | CCCC(=O)Nc1nc2ccc(NC(=O)c3c(F)c(F)c(OC)c(F)c3F)cc2s1 |
| InChI | InChI=1S/C19H15F4N3O3S/c1-3-4-11(27)26-19-25-9-6-5-8(7-10(9)30-19)24-18(28)12-13(20)15(22)17(29-2)16(23)14(12)21/h5-7H,3-4H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | RIRKAHBFVXPFKB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|