About 2-ethyl-1,3-dihydroisoindole-5,6-diol
2-ethyl-1,3-dihydroisoindole-5,6-diol (PubChem CID 22365543) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-ethyl-1,3-dihydroisoindole-5,6-diol.
Molecular Properties
| Compound Name | 2-ethyl-1,3-dihydroisoindole-5,6-diol |
| PubChem CID | 22365543 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-ethyl-1,3-dihydroisoindole-5,6-diol |
| SMILES | CCN1Cc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C10H13NO2/c1-2-11-5-7-3-9(12)10(13)4-8(7)6-11/h3-4,12-13H,2,5-6H2,1H3 |
| InChIKey | WCGJFHBQKUKUSK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,3-dihydroisoindole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-dihydroisoindole-5,6-diol?
The IUPAC name of 2-ethyl-1,3-dihydroisoindole-5,6-diol (CID 22365543) is 2-ethyl-1,3-dihydroisoindole-5,6-diol.
What is the SMILES notation for 2-ethyl-1,3-dihydroisoindole-5,6-diol?
The canonical SMILES for 2-ethyl-1,3-dihydroisoindole-5,6-diol is CCN1Cc2cc(O)c(O)cc2C1.
What is the InChIKey of 2-ethyl-1,3-dihydroisoindole-5,6-diol?
The InChIKey is WCGJFHBQKUKUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-11-5-7-3-9(12)10(13)4-8(7)6-11/h3-4,12-13H,2,5-6H2,1H3.
What are the key properties of 2-ethyl-1,3-dihydroisoindole-5,6-diol?
2-ethyl-1,3-dihydroisoindole-5,6-diol has a molecular weight of 179.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-dihydroisoindole-5,6-diol is sourced from PubChem (CID 22365543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).