About 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide
1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide (PubChem CID 22365596) has the molecular formula C21H41BrN2
and a molecular weight of 401.48 g/mol. Its IUPAC name is 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide.
Molecular Properties
| Compound Name | 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide |
| PubChem CID | 22365596 |
| Molecular Formula | C21H41BrN2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide |
| SMILES | C=C[N+]1(CCCCCCCCCCCCCCCC)C=NCC1.[Br-] |
| InChI | InChI=1S/C21H41N2.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-23(4-2)20-18-22-21-23;/h4,21H,2-3,5-20H2,1H3;1H/q+1;/p-1 |
| InChIKey | KUVFODORCYWJOD-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide?
The IUPAC name of 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide (CID 22365596) is 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide.
What is the SMILES notation for 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide?
The canonical SMILES for 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide is C=C[N+]1(CCCCCCCCCCCCCCCC)C=NCC1.[Br-].
What is the InChIKey of 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide?
The InChIKey is KUVFODORCYWJOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H41N2.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-23(4-2)20-18-22-21-23;/h4,21H,2-3,5-20H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide?
1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide has a molecular weight of 401.48 g/mol, XLogP of 3.47, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium bromide is sourced from PubChem (CID 22365596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).