About 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane
3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane (PubChem CID 22365826) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane.
Molecular Properties
| Compound Name | 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane |
| PubChem CID | 22365826 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane |
| SMILES | CCCCC(CC)(C1OO1)C(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-6-8-9-12(7-2,10-13-14-10)11(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | CIWQMQKBGVYWMW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane?
The IUPAC name of 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane (CID 22365826) is 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane.
What is the SMILES notation for 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane?
The canonical SMILES for 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane is CCCCC(CC)(C1OO1)C(C)(C)C.
What is the InChIKey of 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane?
The InChIKey is CIWQMQKBGVYWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-6-8-9-12(7-2,10-13-14-10)11(3,4)5/h10H,6-9H2,1-5H3.
What are the key properties of 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane?
3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane has a molecular weight of 200.32 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethyl-2,2-dimethylheptan-3-yl)dioxirane is sourced from PubChem (CID 22365826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).