C10H10N2O2S — CID 22366711
2-pyridin-3-yl-1,3-thiazolidine-3,4-dicarbaldehyde (PubChem CID 22366711) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,3-thiazolidine-3,4-dicarbaldehyde.
| Compound Name | 2-pyridin-3-yl-1,3-thiazolidine-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 22366711 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-pyridin-3-yl-1,3-thiazolidine-3,4-dicarbaldehyde |
| SMILES | O=CC1CSC(c2cccnc2)N1C=O |
| InChI | InChI=1S/C10H10N2O2S/c13-5-9-6-15-10(12(9)7-14)8-2-1-3-11-4-8/h1-5,7,9-10H,6H2 |
| InChIKey | XRBXCHJKRLBMRU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|