C17H26O2 — CID 22366859
methyl (3Z,5E,11E)-11-methylcyclotetradeca-3,5,11-triene-1-carboxylate (PubChem CID 22366859) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is methyl (3Z,5E,11E)-11-methylcyclotetradeca-3,5,11-triene-1-carboxylate.
| Compound Name | methyl (3Z,5E,11E)-11-methylcyclotetradeca-3,5,11-triene-1-carboxylate |
|---|---|
| PubChem CID | 22366859 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | methyl (3Z,5E,11E)-11-methylcyclotetradeca-3,5,11-triene-1-carboxylate |
| SMILES | COC(=O)C1C/C=C\C=C\CCCC/C(C)=C/CC1 |
| InChI | InChI=1S/C17H26O2/c1-15-11-8-6-4-3-5-7-9-13-16(14-10-12-15)17(18)19-2/h3,5,7,9,12,16H,4,6,8,10-11,13-14H2,1-2H3/b5-3+,9-7-,15-12+ |
| InChIKey | NJKILHFACVRMON-RMVNFQQISA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|