About Mls002638215
Mls002638215 (PubChem CID 223673) has the molecular formula C19H18O2
and a molecular weight of 278.30 g/mol. Its IUPAC name is 4-hydroxy-2,5-dimethyl-3,4-diphenylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | Mls002638215 |
| PubChem CID | 223673 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-hydroxy-2,5-dimethyl-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | CC1C(=O)C(=C(C1(C2=CC=CC=C2)O)C3=CC=CC=C3)C |
| InChI | InChI=1S/C19H18O2/c1-13-17(15-9-5-3-6-10-15)19(21,14(2)18(13)20)16-11-7-4-8-12-16/h3-12,14,21H,1-2H3 |
| InChIKey | VAAQGIJITBVELH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 438 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Mls002638215 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mls002638215?
The IUPAC name of Mls002638215 (CID 223673) is 4-hydroxy-2,5-dimethyl-3,4-diphenylcyclopent-2-en-1-one.
What is the SMILES notation for Mls002638215?
The canonical SMILES for Mls002638215 is CC1C(=O)C(=C(C1(C2=CC=CC=C2)O)C3=CC=CC=C3)C.
What is the InChIKey of Mls002638215?
The InChIKey is VAAQGIJITBVELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2/c1-13-17(15-9-5-3-6-10-15)19(21,14(2)18(13)20)16-11-7-4-8-12-16/h3-12,14,21H,1-2H3.
What are the key properties of Mls002638215?
Mls002638215 has a molecular weight of 278.30 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Mls002638215 is sourced from PubChem (CID 223673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).