C4H8N4 — CID 22367688
N,3-dimethyl-1,2,4-triazol-1-amine (PubChem CID 22367688) has the molecular formula C4H8N4 and a molecular weight of 112.14 g/mol. Its IUPAC name is N,3-dimethyl-1,2,4-triazol-1-amine.
| Compound Name | N,3-dimethyl-1,2,4-triazol-1-amine |
|---|---|
| PubChem CID | 22367688 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | N,3-dimethyl-1,2,4-triazol-1-amine |
| SMILES | CNn1cnc(C)n1 |
| InChI | InChI=1S/C4H8N4/c1-4-6-3-8(5-2)7-4/h3,5H,1-2H3 |
| InChIKey | IQYFKBCXLYEKTG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |