About 1,3,3-trimethylpiperazine
1,3,3-trimethylpiperazine (PubChem CID 22367738) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1,3,3-trimethylpiperazine.
Molecular Properties
| Compound Name | 1,3,3-trimethylpiperazine |
| PubChem CID | 22367738 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1,3,3-trimethylpiperazine |
| SMILES | CN1CCNC(C)(C)C1 |
| InChI | InChI=1S/C7H16N2/c1-7(2)6-9(3)5-4-8-7/h8H,4-6H2,1-3H3 |
| InChIKey | KVWMFPQRDKFZMP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,3-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3-trimethylpiperazine?
The IUPAC name of 1,3,3-trimethylpiperazine (CID 22367738) is 1,3,3-trimethylpiperazine.
What is the SMILES notation for 1,3,3-trimethylpiperazine?
The canonical SMILES for 1,3,3-trimethylpiperazine is CN1CCNC(C)(C)C1.
What is the InChIKey of 1,3,3-trimethylpiperazine?
The InChIKey is KVWMFPQRDKFZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-7(2)6-9(3)5-4-8-7/h8H,4-6H2,1-3H3.
What are the key properties of 1,3,3-trimethylpiperazine?
1,3,3-trimethylpiperazine has a molecular weight of 128.22 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-trimethylpiperazine is sourced from PubChem (CID 22367738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).