C16H16ClNO4 — CID 22368138
10-prop-2-ynyl-1,2,3,4-tetrahydroacridin-10-ium perchlorate (PubChem CID 22368138) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 10-prop-2-ynyl-1,2,3,4-tetrahydroacridin-10-ium perchlorate.
| Compound Name | 10-prop-2-ynyl-1,2,3,4-tetrahydroacridin-10-ium perchlorate |
|---|---|
| PubChem CID | 22368138 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 10-prop-2-ynyl-1,2,3,4-tetrahydroacridin-10-ium perchlorate |
| SMILES | C#CC[n+]1c2c(cc3ccccc31)CCCC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16N.ClHO4/c1-2-11-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17;2-1(3,4)5/h1,3,5,7,9,12H,4,6,8,10-11H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ISKKGOIXELEHNP-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|