C14H5CaNO7 — CID 22368242
calcium 4,6-dioxo-9H-pyrano[3,2-g]quinoline-2,8-dicarboxylate (PubChem CID 22368242) has the molecular formula C14H5CaNO7 and a molecular weight of 339.27 g/mol. Its IUPAC name is calcium 4,6-dioxo-9H-pyrano[3,2-g]quinoline-2,8-dicarboxylate.
| Compound Name | calcium 4,6-dioxo-9H-pyrano[3,2-g]quinoline-2,8-dicarboxylate |
|---|---|
| PubChem CID | 22368242 |
| Molecular Formula | C14H5CaNO7 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | calcium 4,6-dioxo-9H-pyrano[3,2-g]quinoline-2,8-dicarboxylate |
| SMILES | O=C([O-])c1cc(=O)c2cc3c(=O)cc(C(=O)[O-])oc3cc2[nH]1.[Ca+2] |
| InChI | InChI=1S/C14H7NO7.Ca/c16-9-2-8(13(18)19)15-7-3-11-6(1-5(7)9)10(17)4-12(22-11)14(20)21;/h1-4H,(H,15,16)(H,18,19)(H,20,21);/q;+2/p-2 |
| InChIKey | UCWVCNWPVUAGET-UHFFFAOYSA-L |
| XLogP | -2.02 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|