C14H12F3N5O5S — CID 2236873
4-amino-N-[(5R)-1-methyl-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide (PubChem CID 2236873) has the molecular formula C14H12F3N5O5S and a molecular weight of 419.34 g/mol. Its IUPAC name is 4-amino-N-[(5R)-1-methyl-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide.
| Compound Name | 4-amino-N-[(5R)-1-methyl-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2236873 |
| Molecular Formula | C14H12F3N5O5S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-amino-N-[(5R)-1-methyl-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide |
| SMILES | Cn1c2c(c(=O)[nH]c1=O)[C@](NS(=O)(=O)c1ccc(N)cc1)(C(F)(F)F)C(=O)N2 |
| InChI | InChI=1S/C14H12F3N5O5S/c1-22-9-8(10(23)20-12(22)25)13(11(24)19-9,14(15,16)17)21-28(26,27)7-4-2-6(18)3-5-7/h2-5,21H,18H2,1H3,(H,19,24)(H,20,23,25)/t13-/m1/s1 |
| InChIKey | MMZFQUISAFCXDS-CYBMUJFWSA-N |
| XLogP | -0.66 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|