C7H13NO3 — CID 22368838
(3-methyl-1-oxopentan-2-yl)carbamic acid (PubChem CID 22368838) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (3-methyl-1-oxopentan-2-yl)carbamic acid.
| Compound Name | (3-methyl-1-oxopentan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 22368838 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (3-methyl-1-oxopentan-2-yl)carbamic acid |
| SMILES | CCC(C)C(C=O)NC(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-3-5(2)6(4-9)8-7(10)11/h4-6,8H,3H2,1-2H3,(H,10,11) |
| InChIKey | HESJCIKNILVCIF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|