About [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone
[4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 2236889) has the molecular formula C24H24N6O
and a molecular weight of 412.50 g/mol. Its IUPAC name is [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone |
| PubChem CID | 2236889 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1cc(C)n(-c2nc3ccccc3nc2N2CCN(C(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C24H24N6O/c1-17-16-18(2)30(27-17)23-22(25-20-10-6-7-11-21(20)26-23)28-12-14-29(15-13-28)24(31)19-8-4-3-5-9-19/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | QSKWBECPCFIYRL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone (CID 2236889) is [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone is Cc1cc(C)n(-c2nc3ccccc3nc2N2CCN(C(=O)c3ccccc3)CC2)n1.
What is the InChIKey of [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone?
The InChIKey is QSKWBECPCFIYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N6O/c1-17-16-18(2)30(27-17)23-22(25-20-10-6-7-11-21(20)26-23)28-12-14-29(15-13-28)24(31)19-8-4-3-5-9-19/h3-11,16H,12-15H2,1-2H3.
What are the key properties of [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone?
[4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone has a molecular weight of 412.50 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]piperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 2236889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).