C14H8F6S2 — CID 22369035
3-(2,3,4,4,5,5-hexafluorocyclopent-2-en-1-yl)-2-methyl-5-thiophen-2-ylthiophene (PubChem CID 22369035) has the molecular formula C14H8F6S2 and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-(2,3,4,4,5,5-hexafluorocyclopent-2-en-1-yl)-2-methyl-5-thiophen-2-ylthiophene.
| Compound Name | 3-(2,3,4,4,5,5-hexafluorocyclopent-2-en-1-yl)-2-methyl-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 22369035 |
| Molecular Formula | C14H8F6S2 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-(2,3,4,4,5,5-hexafluorocyclopent-2-en-1-yl)-2-methyl-5-thiophen-2-ylthiophene |
| SMILES | Cc1sc(-c2cccs2)cc1C1C(F)=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H8F6S2/c1-6-7(5-9(22-6)8-3-2-4-21-8)10-11(15)12(16)14(19,20)13(10,17)18/h2-5,10H,1H3 |
| InChIKey | BWSLXFBSVPLMPH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|