About sodium;prop-1-ene;sulfoazanide
sodium;prop-1-ene;sulfoazanide (PubChem CID 22369884) has the molecular formula C3H8NNaO3S
and a molecular weight of 161.16 g/mol. Its IUPAC name is sodium;prop-1-ene;sulfoazanide.
Molecular Properties
| Compound Name | sodium;prop-1-ene;sulfoazanide |
| PubChem CID | 22369884 |
| Molecular Formula | C3H8NNaO3S |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | sodium;prop-1-ene;sulfoazanide |
| SMILES | C=CC.[NH-]S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C3H6.H2NO3S.Na/c1-3-2;1-5(2,3)4;/h3H,1H2,2H3;(H2-,1,2,3,4);/q;-1;+1 |
| InChIKey | SOLQXZLNKPLSGI-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;prop-1-ene;sulfoazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;prop-1-ene;sulfoazanide?
The IUPAC name of sodium;prop-1-ene;sulfoazanide (CID 22369884) is sodium;prop-1-ene;sulfoazanide.
What is the SMILES notation for sodium;prop-1-ene;sulfoazanide?
The canonical SMILES for sodium;prop-1-ene;sulfoazanide is C=CC.[NH-]S(=O)(=O)O.[Na+].
What is the InChIKey of sodium;prop-1-ene;sulfoazanide?
The InChIKey is SOLQXZLNKPLSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6.H2NO3S.Na/c1-3-2;1-5(2,3)4;/h3H,1H2,2H3;(H2-,1,2,3,4);/q;-1;+1.
What are the key properties of sodium;prop-1-ene;sulfoazanide?
sodium;prop-1-ene;sulfoazanide has a molecular weight of 161.16 g/mol, XLogP of -1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;prop-1-ene;sulfoazanide is sourced from PubChem (CID 22369884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).