C9H9Cl3N2 — CID 22370
N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride (PubChem CID 22370) has the molecular formula C9H9Cl3N2 and a molecular weight of 251.54 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride.
| Compound Name | N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 22370 |
| Molecular Formula | C9H9Cl3N2 |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride |
| SMILES | CN(C)/C(Cl)=N/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl3N2/c1-14(2)9(12)13-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3/b13-9+ |
| InChIKey | WKQYAIDXQNGNIQ-UKTHLTGXSA-N |
| XLogP | 3.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|