C20H16N2O6S — CID 22370246
3-[[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22370246) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is 3-[[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22370246 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 3-[[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1Cc1ccc(OCCON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H16N2O6S/c23-17-12-29-20(26)21(17)11-13-5-7-14(8-6-13)27-9-10-28-22-18(24)15-3-1-2-4-16(15)19(22)25/h1-8H,9-12H2 |
| InChIKey | NPOCQXMBZVTTSG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|