About dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide
dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide (PubChem CID 22370881) has the molecular formula C28H30BN
and a molecular weight of 391.37 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide.
Molecular Properties
| Compound Name | dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide |
| PubChem CID | 22370881 |
| Molecular Formula | C28H30BN |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide |
| SMILES | C=C[B-](c1ccccc1)(c1ccccc1)c1ccccc1.C[NH+](C)c1ccccc1 |
| InChI | InChI=1S/C20H18B.C8H11N/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-9(2)8-6-4-3-5-7-8/h2-17H,1H2;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | LHJHNQLGJZHKTP-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide?
The IUPAC name of dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide (CID 22370881) is dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide.
What is the SMILES notation for dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide?
The canonical SMILES for dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide is C=C[B-](c1ccccc1)(c1ccccc1)c1ccccc1.C[NH+](C)c1ccccc1.
What is the InChIKey of dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide?
The InChIKey is LHJHNQLGJZHKTP-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H18B.C8H11N/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-9(2)8-6-4-3-5-7-8/h2-17H,1H2;3-7H,1-2H3/q-1;/p+1.
What are the key properties of dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide?
dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide has a molecular weight of 391.37 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)azanium;ethenyl(triphenyl)boranuide is sourced from PubChem (CID 22370881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).