C14H29N3S — CID 22371532
1-butyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)thiourea (PubChem CID 22371532) has the molecular formula C14H29N3S and a molecular weight of 271.47 g/mol. Its IUPAC name is 1-butyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)thiourea.
| Compound Name | 1-butyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)thiourea |
|---|---|
| PubChem CID | 22371532 |
| Molecular Formula | C14H29N3S |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 1-butyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)thiourea |
| SMILES | CCCCNC(=S)NN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C14H29N3S/c1-6-7-11-15-12(18)16-17-13(2,3)9-8-10-14(17,4)5/h6-11H2,1-5H3,(H2,15,16,18) |
| InChIKey | KIUHAHUPPMWORA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|