C21H42O5 — CID 22371562
6,9,12-trimethoxyoctadecanoic acid (PubChem CID 22371562) has the molecular formula C21H42O5 and a molecular weight of 374.56 g/mol. Its IUPAC name is 6,9,12-trimethoxyoctadecanoic acid.
| Compound Name | 6,9,12-trimethoxyoctadecanoic acid |
|---|---|
| PubChem CID | 22371562 |
| Molecular Formula | C21H42O5 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 6,9,12-trimethoxyoctadecanoic acid |
| SMILES | CCCCCCC(CCC(CCC(CCCCC(=O)O)OC)OC)OC |
| InChI | InChI=1S/C21H42O5/c1-5-6-7-8-11-18(24-2)14-16-20(26-4)17-15-19(25-3)12-9-10-13-21(22)23/h18-20H,5-17H2,1-4H3,(H,22,23) |
| InChIKey | JGZJLAZSRBSTSO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|