About quinoline-6,7-dione
quinoline-6,7-dione (PubChem CID 22371656) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is quinoline-6,7-dione.
Molecular Properties
| Compound Name | quinoline-6,7-dione |
| PubChem CID | 22371656 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | quinoline-6,7-dione |
| SMILES | O=C1C=c2cccnc2=CC1=O |
| InChI | InChI=1S/C9H5NO2/c11-8-4-6-2-1-3-10-7(6)5-9(8)12/h1-5H |
| InChIKey | XBBHFYPOVGKQTR-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze quinoline-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-6,7-dione?
The IUPAC name of quinoline-6,7-dione (CID 22371656) is quinoline-6,7-dione.
What is the SMILES notation for quinoline-6,7-dione?
The canonical SMILES for quinoline-6,7-dione is O=C1C=c2cccnc2=CC1=O.
What is the InChIKey of quinoline-6,7-dione?
The InChIKey is XBBHFYPOVGKQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c11-8-4-6-2-1-3-10-7(6)5-9(8)12/h1-5H.
What are the key properties of quinoline-6,7-dione?
quinoline-6,7-dione has a molecular weight of 159.14 g/mol, XLogP of -1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-6,7-dione is sourced from PubChem (CID 22371656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).