C21H24N2O5 — CID 2237189
3-(2-methoxyphenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 2237189) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-methoxyphenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2237189 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-(2-methoxyphenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCOc1cc(-c2nc(-c3ccccc3OC)no2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H24N2O5/c1-5-25-17-12-14(13-18(26-6-2)19(17)27-7-3)21-22-20(23-28-21)15-10-8-9-11-16(15)24-4/h8-13H,5-7H2,1-4H3 |
| InChIKey | PJPGIAYPQOPGQQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |