C19H16ClIN2O4 — CID 2237226
(4S)-5-acetyl-4-(2-chloro-4-hydroxy-3-iodo-5-methoxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 2237226) has the molecular formula C19H16ClIN2O4 and a molecular weight of 498.70 g/mol. Its IUPAC name is (4S)-5-acetyl-4-(2-chloro-4-hydroxy-3-iodo-5-methoxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-5-acetyl-4-(2-chloro-4-hydroxy-3-iodo-5-methoxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 2237226 |
| Molecular Formula | C19H16ClIN2O4 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | (4S)-5-acetyl-4-(2-chloro-4-hydroxy-3-iodo-5-methoxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | COc1cc([C@H]2NC(=O)NC(c3ccccc3)=C2C(C)=O)c(Cl)c(I)c1O |
| InChI | InChI=1S/C19H16ClIN2O4/c1-9(24)13-16(10-6-4-3-5-7-10)22-19(26)23-17(13)11-8-12(27-2)18(25)15(21)14(11)20/h3-8,17,25H,1-2H3,(H2,22,23,26)/t17-/m1/s1 |
| InChIKey | KWPFWLJJVGDPOB-QGZVFWFLSA-N |
| XLogP | 4.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|