About 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide
3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide (PubChem CID 2237241) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide |
| PubChem CID | 2237241 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide |
| SMILES | Cc1ccc(NC(=O)CC(N)=NO)cc1C |
| InChI | InChI=1S/C11H15N3O2/c1-7-3-4-9(5-8(7)2)13-11(15)6-10(12)14-16/h3-5,16H,6H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | DVWPGUAFIFGDTN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide?
The IUPAC name of 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide (CID 2237241) is 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide.
What is the SMILES notation for 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide?
The canonical SMILES for 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide is Cc1ccc(NC(=O)CC(N)=NO)cc1C.
What is the InChIKey of 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide?
The InChIKey is DVWPGUAFIFGDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-7-3-4-9(5-8(7)2)13-11(15)6-10(12)14-16/h3-5,16H,6H2,1-2H3,(H2,12,14)(H,13,15).
What are the key properties of 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide?
3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide has a molecular weight of 221.26 g/mol, XLogP of 1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,4-dimethylphenyl)-3-hydroxyiminopropanamide is sourced from PubChem (CID 2237241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).