C17H25N3O3 — CID 2237330
N-(2,4-dimethylphenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide (PubChem CID 2237330) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 2237330 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-11-6-7-13(12(2)10-11)18-14(21)8-9-15(22)19-20-16(23)17(3,4)5/h6-7,10H,8-9H2,1-5H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | YSVOFZQLNJHLNE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|